CAS 88162-09-8

2-({[2-(carboxymethyl)-4-oxohexyl]oxy}carbonyl)benzoic acid

Description:

2-({[2-(carboxymethyl)-4-oxohexyl]oxy}carbonyl)benzoic acid, with the CAS number 88162-09-8, is a chemical compound characterized by its complex structure, which includes both carboxylic acid and ester functional groups. This compound features a benzoic acid moiety, indicating it has aromatic characteristics, and is further substituted with a carbon chain that contains a carboxymethyl group and a ketone functionality. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the ester linkage may allow for further chemical reactivity, such as hydrolysis or transesterification. The compound's solubility is likely influenced by the polar carboxymethyl group, making it more soluble in polar solvents. Additionally, the presence of multiple functional groups indicates potential applications in pharmaceuticals, biochemistry, or materials science, where it may serve as an intermediate or a building block for more complex molecules. Overall, this compound exemplifies the diversity of organic chemistry and the intricate relationships between structure and reactivity.

Formula: C₁₆H₁₈O₇

InChI: InChI=1/C16H18O7/c1-2-11(17)7-10(8-14(18)19)9-23-16(22)13-6-4-3-5-12(13)15(20)21/h3-6,10H,2,7-9H2,1H3,(H,18,19)(H,20,21)

1,2-Benzenedicarboxylicacid, 1-[2-(carboxymethyl)-4-oxohexyl] ester

CAS: 88162-09-8

Formula: C₁₆H₁₈O₇

Molecular weight: 322.3099

Ref: IN-DA004FZM