CymitQuimica logo

CAS 88162-10-1

:

2-{[(5-carboxy-2-ethyl-4-hydroxypentyl)oxy]carbonyl}benzoic acid

Description:
2-{[(5-carboxy-2-ethyl-4-hydroxypentyl)oxy]carbonyl}benzoic acid, with the CAS number 88162-10-1, is a complex organic compound characterized by its carboxylic acid functional group and an ether linkage. This substance features a benzoic acid core, which is substituted with a carbonyl group and a long aliphatic chain that includes a hydroxyl group, contributing to its potential solubility in various solvents. The presence of multiple functional groups suggests that it may exhibit both hydrophilic and hydrophobic properties, making it suitable for applications in pharmaceuticals, agrochemicals, or as a surfactant. Its structural complexity may also impart unique reactivity, allowing for various chemical transformations. Additionally, the compound's carboxylic acid group can participate in acid-base reactions, while the hydroxyl group may engage in hydrogen bonding, influencing its physical properties such as melting point and solubility. Overall, this compound's characteristics make it a subject of interest in chemical research and potential industrial applications.
Formula:C16H20O7
InChI:InChI=1/C16H20O7/c1-2-10(7-11(17)8-14(18)19)9-23-16(22)13-6-4-3-5-12(13)15(20)21/h3-6,10-11,17H,2,7-9H2,1H3,(H,18,19)(H,20,21)
SMILES:CCC(CC(CC(=O)O)O)COC(=O)c1ccccc1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.