CAS 88164-54-9

4-hydrazino-7-(trifluoromethyl)quinoline hydrochloride

Description:

4-Hydrazino-7-(trifluoromethyl)quinoline hydrochloride is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with a hydrazino group and a trifluoromethyl group. This compound typically appears as a crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The hydrazino group can participate in various chemical reactions, including hydrazone formation and potential redox reactions. This compound may exhibit pharmacological properties, which could be explored for applications in drug development, particularly in the context of antitumor or antimicrobial activities. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Proper storage and disposal methods should be followed to ensure safety and compliance with regulations.

Formula: C₁₀H₉ClF₃N₃

InChI: InChI=1/C10H8F3N3.ClH/c11-10(12,13)6-1-2-7-8(16-14)3-4-15-9(7)5-6;/h1-5H,14H2,(H,15,16);1H

SMILES: c1cc2c(ccnc2cc1C(F)(F)F)NN.Cl

Synonyms:

• 4-Hydrazino-7-(trifluoromethyl)quinoline hydrochloride (1:1)

4-Hydrazino 7-trifluoromethyl-quinoline hydrochloride

CAS: 88164-54-9

4-Hydrazino 7-trifluoromethyl-quinoline hydrochloride

Purity: ≥95%

Molecular weight: 263.65g/mol

Ref: 54-PC404551