CAS 88164-55-0
:3-Pyrazolidinone, 1-(3-quinolinyl)-
Description:
3-Pyrazolidinone, 1-(3-quinolinyl)-, with the CAS number 88164-55-0, is a chemical compound characterized by its pyrazolidinone core structure fused with a quinoline moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its moderate polarity. The presence of both the pyrazolidinone and quinoline rings suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may engage in hydrogen bonding due to the functional groups present, influencing its reactivity and interactions with biological targets. Additionally, its structural features may confer specific pharmacokinetic properties, such as absorption and distribution in biological systems. As with many heterocyclic compounds, it may also exhibit unique spectroscopic characteristics, making it identifiable through techniques such as NMR and mass spectrometry. Overall, 3-Pyrazolidinone, 1-(3-quinolinyl)- represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of anti-inflammatory or antimicrobial research.
Formula:C12H11N3O
InChI:InChI=1S/C12H11N3O/c16-12-5-6-15(14-12)10-7-9-3-1-2-4-11(9)13-8-10/h1-4,7-8H,5-6H2,(H,14,16)
InChI key:InChIKey=QNZORRWYDCGEJJ-UHFFFAOYSA-N
SMILES:O=C1NN(C2=CC3=C(N=C2)C=CC=C3)CC1
Synonyms:- 3-Pyrazolidinone, 1-(3-quinolinyl)-
- 1-Quinolin-3-ylpyrazolidin-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
