CAS 88165-64-4

1(2H)-Phenanthrenone, 3,4,5,6,7,8,8a,9,10,10a-decahydro-

Description:

1(2H)-Phenanthrenone, 3,4,5,6,7,8,8a,9,10,10a-decahydro- is a polycyclic aromatic ketone characterized by its complex fused ring structure. This compound features a phenanthrene backbone with a ketone functional group, which contributes to its chemical reactivity and potential applications in organic synthesis. The presence of multiple hydrogen atoms indicates that it is a saturated derivative of phenanthrenone, which may influence its physical properties such as melting and boiling points, solubility, and stability. Typically, compounds of this nature exhibit interesting photophysical properties, making them of interest in fields such as materials science and organic electronics. Additionally, the structure suggests potential biological activity, which could be explored in medicinal chemistry. The CAS number 88165-64-4 uniquely identifies this compound, facilitating its recognition in chemical databases and literature. Overall, this substance represents a fascinating area of study within organic chemistry due to its structural complexity and potential applications.

Formula: C₁₄H₂₀O

InChI: InChI=1S/C14H20O/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h10,13H,1-9H2

InChI key: SAMRDLQNXMSKKQ-UHFFFAOYSA-N

SMILES: C1CCC2=C3CCCC(=O)C3CCC2C1