CAS 88165-71-3

Borinic acid, bis(1-methylpropyl)-, 1-cyclopenten-1-yl ester

Description:

Borinic acid, bis(1-methylpropyl)-, 1-cyclopenten-1-yl ester, identified by CAS number 88165-71-3, is an organoboron compound characterized by the presence of a boron atom bonded to two 1-methylpropyl groups and an ester functional group derived from cyclopentene. This compound typically exhibits properties associated with boron-containing compounds, such as potential reactivity in organic synthesis and coordination chemistry. The presence of the cyclopentenyl ester suggests that it may participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. Borinic acids are known for their ability to act as Lewis acids, which can facilitate reactions with nucleophiles. Additionally, the steric bulk provided by the 1-methylpropyl groups may influence its reactivity and solubility in organic solvents. Overall, this compound may find applications in organic synthesis, materials science, and potentially in medicinal chemistry, although specific applications would depend on further research and characterization.

Formula: C₁₃H₂₅BO

InChI: InChI=1S/C13H25BO/c1-5-11(3)14(12(4)6-2)15-13-9-7-8-10-13/h9,11-12H,5-8,10H2,1-4H3

InChI key: UHHBLARYUJTTNA-UHFFFAOYSA-N

SMILES: B(C(C)CC)(C(C)CC)OC1=CCCC1