CAS 88166-77-2
:N-(2,4,5-Trimethylphenyl)acetamide
Description:
N-(2,4,5-Trimethylphenyl)acetamide, with the CAS number 88166-77-2, is an organic compound characterized by its amide functional group, which is derived from acetic acid and a substituted aniline. This compound features a trimethyl-substituted phenyl group, indicating the presence of three methyl groups attached to the aromatic ring at the 2, 4, and 5 positions. The molecular structure contributes to its unique physical and chemical properties, including potential solubility in organic solvents and moderate stability under standard conditions. It may exhibit biological activity, making it of interest in pharmaceutical and chemical research. The presence of the acetamide moiety suggests potential applications in synthesis and as a building block in organic chemistry. Additionally, the compound's characteristics, such as melting point, boiling point, and reactivity, would depend on its specific molecular interactions and the environment in which it is studied. Safety data and handling precautions should be consulted due to the potential hazards associated with amides and aromatic compounds.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-7-5-9(3)11(6-8(7)2)12-10(4)13/h5-6H,1-4H3,(H,12,13)
InChI key:InChIKey=SWNMYEWTIFFJIV-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(C)C=C(C)C(C)=C1
Synonyms:- Acetamide, N-(2,4,5-trimethylphenyl)-
- N-(2,4,5-Trimethylphenyl)acetamide
- Acetanilide, 2′,4′,5′-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
