
CAS 881668-94-6
:6-Chloro-2-methyl-3-quinolinamine
Description:
6-Chloro-2-methyl-3-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, while its solubility in water may be limited. It is often used in pharmaceutical research and development due to its potential biological activity, particularly in the field of medicinal chemistry. The amine functional group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific reactivity patterns, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C10H9ClN2
InChI:InChI=1S/C10H9ClN2/c1-6-9(12)5-7-4-8(11)2-3-10(7)13-6/h2-5H,12H2,1H3
InChI key:InChIKey=LCFOVFMKMAQWPI-UHFFFAOYSA-N
SMILES:NC1=CC2=C(N=C1C)C=CC(Cl)=C2
Synonyms:- 3-Quinolinamine, 6-chloro-2-methyl-
- 6-Chloro-2-methyl-3-quinolinamine
- 3-Amino-6-chloro-2-methylquinoline
- 6-Chloro-2-Methylquinolin-3-aMine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
