CAS 88167-12-8
:trimethyl 5-[(1E)-3-(dimethylamino)-3-oxoprop-1-en-1-yl]benzene-1,2,3-trisulfenate
Description:
Trimethyl 5-[(1E)-3-(dimethylamino)-3-oxoprop-1-en-1-yl]benzene-1,2,3-trisulfenate is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with three sulfenate groups and a dimethylamino group attached to a prop-1-en-1-yl chain. The presence of multiple sulfenate groups suggests that this compound may exhibit significant reactivity, particularly in nucleophilic substitution reactions or as a potential electrophile. The dimethylamino group contributes to the compound's basicity and may influence its solubility and interaction with other chemical species. This compound is likely to be of interest in organic synthesis and materials science due to its unique functional groups. Additionally, the presence of the enone moiety indicates potential for conjugate addition reactions. As with many organosulfur compounds, it may also exhibit interesting biological activities, although specific studies would be necessary to elucidate its properties and potential applications. Safety and handling precautions should be observed due to the reactivity associated with sulfenate groups.
Formula:C14H19NO4S3
InChI:InChI=1/C14H19NO4S3/c1-15(2)13(16)7-6-10-8-11(20-17-3)14(22-19-5)12(9-10)21-18-4/h6-9H,1-5H3/b7-6+
Synonyms:- Cinnamamide, N,N-dimethyl-3,4,5-trimethoxythio-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
