CAS 88167-34-4
:5-iodo-1-prop-2-yn-1-ylpyrimidin-2(1H)-one
Description:
5-Iodo-1-prop-2-yn-1-ylpyrimidin-2(1H)-one is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with an iodine atom and a propargyl group. This compound features a pyrimidinone moiety, indicating the presence of a carbonyl group adjacent to the nitrogen in the ring, contributing to its reactivity and potential biological activity. The propargyl group, characterized by a triple bond between carbon atoms, enhances the compound's ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The iodine substituent can influence the compound's electronic properties and reactivity, making it of interest in medicinal chemistry and organic synthesis. Additionally, the presence of the pyrimidine ring suggests potential applications in pharmaceuticals, as pyrimidine derivatives are often explored for their biological activities, including antiviral and anticancer properties. Overall, 5-iodo-1-prop-2-yn-1-ylpyrimidin-2(1H)-one is a versatile compound with significant implications in chemical research and drug development.
Formula:C7H5IN2O
InChI:InChI=1/C7H5IN2O/c1-2-3-10-5-6(8)4-9-7(10)11/h1,4-5H,3H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
