CAS 88167-46-8

Ethanone, 2-bromo-1-[3,5-dichloro-4-(di-2-propenylamino)phenyl]-

Description:

Ethanone, 2-bromo-1-[3,5-dichloro-4-(di-2-propenylamino)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a bromine atom and multiple chlorine substituents on a phenyl ring. This compound features a ketone functional group (ethanone) and is notable for its di-2-propenylamino side chain, which may impart specific biological activities or reactivity. The presence of halogens, such as bromine and chlorine, often enhances the compound's stability and can influence its reactivity in various chemical reactions. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the amino group, which can participate in further chemical modifications. Its molecular interactions may be significant in biological systems, making it a subject of interest in medicinal chemistry. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential when handling or utilizing this substance.

Formula: C₁₄H₁₄BrCl₂NO

InChI: InChI=1S/C14H14BrCl2NO/c1-3-5-18(6-4-2)14-11(16)7-10(8-12(14)17)13(19)9-15/h3-4,7-8H,1-2,5-6,9H2

InChI key: DEZZOKAWGBWVLU-UHFFFAOYSA-N

SMILES: C=CCN(CC=C)C1=C(C=C(C=C1Cl)C(=O)CBr)Cl