CAS 88167-57-1
:Methyl 4-(acetyloxy)hexadecanoate
Description:
Methyl 4-(acetyloxy)hexadecanoate, with the CAS number 88167-57-1, is an ester derived from hexadecanoic acid (palmitic acid) and acetic acid. This compound features a long hydrophobic hydrocarbon chain, which contributes to its lipophilic properties, making it soluble in organic solvents but less so in water. The presence of the acetyloxy functional group introduces a polar character, which can enhance its reactivity and potential applications in various chemical processes. Methyl 4-(acetyloxy)hexadecanoate is typically used in the synthesis of surfactants, emulsifiers, and other chemical intermediates. Its structure suggests it may exhibit characteristics typical of fatty acid esters, such as low volatility and stability under standard conditions. Additionally, it may possess biological activity, making it of interest in fields such as pharmaceuticals or cosmetics. As with many esters, it may also undergo hydrolysis in the presence of water or under acidic or basic conditions, reverting to its constituent acids.
Formula:C19H36O4
InChI:InChI=1S/C19H36O4/c1-4-5-6-7-8-9-10-11-12-13-14-18(23-17(2)20)15-16-19(21)22-3/h18H,4-16H2,1-3H3
InChI key:InChIKey=FSDQECZCDCZROJ-UHFFFAOYSA-N
SMILES:C(CCC(OC)=O)(CCCCCCCCCCCC)OC(C)=O
Synonyms:- Methyl 4-(acetyloxy)hexadecanoate
- Hexadecanoic acid, 4-(acetyloxy)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
