CAS 88168-64-3

2-Thietanone, 4,4-dimethyl-3-[[(4-nitrophenyl)methylene]amino]-, (R)-

Description:

2-Thietanone, 4,4-dimethyl-3-[[(4-nitrophenyl)methylene]amino]-, (R)-, with CAS number 88168-64-3, is a chemical compound characterized by its thietane ring structure, which is a five-membered ring containing a sulfur atom. This compound features a ketone functional group and a substituted amino group, specifically a methylene linkage to a 4-nitrophenyl moiety, contributing to its potential reactivity and biological activity. The presence of the nitro group enhances its electron-withdrawing properties, which can influence its chemical behavior and interactions. The (R)- designation indicates that the compound has a specific stereochemistry, which can be crucial for its biological activity and interactions with other molecules. This compound may exhibit properties typical of thietanones, such as potential antimicrobial or antifungal activities, and could be of interest in medicinal chemistry or materials science. Its unique structure and functional groups suggest that it may participate in various chemical reactions, making it a subject of interest for further research and application in synthetic chemistry.

Formula: C₁₂H₁₂N₂O₃S

InChI: InChI=1S/C12H12N2O3S/c1-12(2)10(11(15)18-12)13-7-8-3-5-9(6-4-8)14(16)17/h3-7,10H,1-2H3/t10-/m0/s1

InChI key: MLWQFTLFMKOEDB-JTQLQIEISA-N

SMILES: CC1([C@H](C(=O)S1)N=CC2=CC=C(C=C2)[N+](=O)[O-])C