CAS 88168-90-5

Gingerglycolipid B

Description:

Gingerglycolipid B, with the CAS number 88168-90-5, is a glycolipid derived from ginger (Zingiber officinale) known for its potential bioactive properties. This compound typically features a hydrophobic lipid tail and a hydrophilic carbohydrate moiety, which contributes to its amphiphilic nature, allowing it to interact with both lipid and aqueous environments. Gingerglycolipid B is recognized for its possible health benefits, including anti-inflammatory and antioxidant activities, which may be attributed to its structural components. The compound's unique configuration may also facilitate its role in cell membrane dynamics and signaling pathways. Research into gingerglycolipids, including Gingerglycolipid B, is ongoing, focusing on their applications in food science, pharmaceuticals, and nutraceuticals. As with many natural products, the specific characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other substances. Overall, Gingerglycolipid B represents a fascinating area of study within the field of natural product chemistry and its implications for health and wellness.

Formula: C₃₃H₅₈O₁₄

InChI: InChI=1S/C33H58O14/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(36)43-19-22(35)20-44-32-31(42)29(40)27(38)24(47-32)21-45-33-30(41)28(39)26(37)23(18-34)46-33/h6-7,9-10,22-24,26-35,37-42H,2-5,8,11-21H2,1H3/b7-6-,10-9-/t22-,23-,24-,26+,27+,28+,29+,30-,31-,32-,33+/m1/s1

InChI key: InChIKey=UHISGSDYAIIBMO-UMLSMIIMSA-N

SMILES: C(O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H]2O[C@@H](OC[C@@H](COC(CCCCCCC/C=C\C/C=C\CCCCC)=O)O)[C@H](O)[C@@H](O)[C@H]2O

Synonyms:

• Gingerglycolipid B
• β-D-Galactopyranoside, (2S)-2-hydroxy-3-[[(9Z,12Z)-1-oxo-9,12-octadecadienyl]oxy]propyl 6-O-α-D-galactopyranosyl-
• β-D-Galactopyranoside, 2-hydroxy-3-[(1-oxo-9,12-octadecadienyl)oxy]propyl 6-O-α-D-galactopyranosyl-, [S-(Z,Z)]-
• β-D-Galactopyranoside, (2S)-2-hydroxy-3-[[(9Z,12Z)-1-oxo-9,12-octadecadien-1-yl]oxy]propyl 6-O-α-D-galactopyranosyl-
• (2S)-2-Hydroxy-3-[[(9Z,12Z)-1-oxo-9,12-octadecadien-1-yl]oxy]propyl 6-O-α-D-galactopyranosyl-β-D-galactopyranoside

Gingerglycolipid B

CAS: 88168-90-5

Gingerglycolipid B is a useful organic compound for research related to life sciences. The catalog number is T124005 and the CAS number is 88168-90-5.

Formula: C₃₃H₅₈O₁₄

Color and Shape: Solid

Molecular weight: 678.813

Ref: TM-T124005