CAS 88169-61-3
:S-(2-bromoethyl)-L-cysteine
Description:
S-(2-bromoethyl)-L-cysteine is an organosulfur compound characterized by the presence of a bromine atom attached to a two-carbon ethyl chain, which is further linked to the thiol group of the amino acid L-cysteine. This compound features a chiral center, making it optically active. It is typically used in biochemical research, particularly in studies involving protein modification and the investigation of cysteine residues in proteins due to its ability to form covalent bonds with thiol groups. The presence of the bromine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. S-(2-bromoethyl)-L-cysteine is soluble in polar solvents, and its reactivity can be influenced by the surrounding pH and the presence of other nucleophiles. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, S-(2-bromoethyl)-L-cysteine serves as a valuable tool in chemical biology and medicinal chemistry for probing cysteine functionality in various biological systems.
Formula:C5H10BrNO2S
InChI:InChI=1/C5H10BrNO2S/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,7H2,(H,8,9)/t4-/m0/s1
Synonyms:- L-Cysteine, S-(2-bromoethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
