CAS 88172-54-7

9H-Fluorene-9-methanol, 9-(2-methylphenyl)-

Description:

9H-Fluorene-9-methanol, 9-(2-methylphenyl)-, with the CAS number 88172-54-7, is an organic compound characterized by its structure, which includes a fluorene core substituted with a methanol group and a 2-methylphenyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. It is likely to be a solid at room temperature, given the presence of multiple aromatic rings, which contribute to its melting point. The hydroxyl (-OH) group in the methanol moiety can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the presence of the 2-methylphenyl group may affect its electronic properties and reactivity, potentially making it useful in various chemical applications, including organic synthesis and as a building block in materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₂₁H₁₈O

InChI: InChI=1S/C21H18O/c1-15-8-2-5-11-18(15)21(14-22)19-12-6-3-9-16(19)17-10-4-7-13-20(17)21/h2-13,22H,14H2,1H3

InChI key: SSUWLXGQQCVAPY-UHFFFAOYSA-N

SMILES: CC1=CC=CC=C1C2(C3=CC=CC=C3C4=CC=CC=C42)CO