CAS 88172-87-6

Acetamide, N-[2,6-bis[[(4-methylphenyl)sulfonyl]oxy]phenyl]-

Description:

Acetamide, N-[2,6-bis[[(4-methylphenyl)sulfonyl]oxy]phenyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a complex structure that includes a phenyl ring substituted with sulfonate groups, specifically 4-methylphenylsulfonyl groups, which enhance its solubility and reactivity. The presence of multiple sulfonyl groups contributes to its potential as a versatile reagent in organic synthesis and medicinal chemistry. Acetamides generally exhibit moderate polarity, which can influence their solubility in various solvents. The compound may also display biological activity, making it of interest in pharmaceutical research. Its CAS number, 88172-87-6, allows for easy identification in chemical databases. Overall, this compound's unique structural features and functional groups suggest potential applications in various chemical and biological contexts, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.

Formula: C₂₂H₂₁NO₇S₂

InChI: InChI=1S/C22H21NO7S2/c1-15-7-11-18(12-8-15)31(25,26)29-20-5-4-6-21(22(20)23-17(3)24)30-32(27,28)19-13-9-16(2)10-14-19/h4-14H,1-3H3,(H,23,24)

InChI key: KRVDNUJECOHODO-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)S(=O)(=O)OC2=C(C(=CC=C2)OS(=O)(=O)C3=CC=C(C=C3)C)NC(=O)C