CAS 88174-31-6
:2-Ethyl-3,4,5,6-tetramethylbenzaldehyde
Description:
2-Ethyl-3,4,5,6-tetramethylbenzaldehyde, with the CAS number 88174-31-6, is an aromatic aldehyde characterized by its complex structure, which includes a benzene ring substituted with multiple alkyl groups. This compound features an ethyl group and four methyl groups attached to the benzene ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the aldehyde functional group (-CHO) makes it reactive, particularly in condensation reactions and as a potential precursor in organic synthesis. Its solubility in organic solvents and limited solubility in water are typical for such compounds. Additionally, 2-Ethyl-3,4,5,6-tetramethylbenzaldehyde may exhibit various physical properties such as boiling point and melting point that are influenced by its molecular structure. Due to its aromatic nature, it may also participate in electrophilic substitution reactions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H18O
InChI:InChI=1S/C13H18O/c1-6-12-10(4)8(2)9(3)11(5)13(12)7-14/h7H,6H2,1-5H3
InChI key:InChIKey=KBNHZJLHQQCOAW-UHFFFAOYSA-N
SMILES:C(C)C1=C(C=O)C(C)=C(C)C(C)=C1C
Synonyms:- Benzaldehyde, 2-ethyl-3,4,5,6-tetramethyl-
- 2-Ethyl-3,4,5,6-tetramethylbenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
