CAS 88174-46-3
:3-Chloro-6-methoxy-2,4-dimethylbenzaldehyde
Description:
3-Chloro-6-methoxy-2,4-dimethylbenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a chlorine atom and a methoxy group (-OCH3) attached to the benzene ring, along with two methyl groups (-CH3) at the 2 and 4 positions. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate polarity due to the presence of the aldehyde and methoxy groups, which can participate in hydrogen bonding. The chlorine atom can also affect the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound may be utilized in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical substances. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C10H11ClO2
InChI:InChI=1S/C10H11ClO2/c1-6-4-9(13-3)8(5-12)7(2)10(6)11/h4-5H,1-3H3
InChI key:InChIKey=ZIKUJKJGSYOYIN-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=O)C(C)=C(Cl)C(C)=C1
Synonyms:- o-Anisaldehyde, 5-chloro-4,6-dimethyl-
- 3-Chloro-6-methoxy-2,4-dimethylbenzaldehyde
- Benzaldehyde, 3-chloro-6-methoxy-2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
