CAS 88174-47-4
:Benzaldehyde, 3-fluoro-2,4,5,6-tetramethyl-
Description:
Benzaldehyde, 3-fluoro-2,4,5,6-tetramethyl- is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a formyl group (–CHO) and multiple methyl groups. The presence of a fluorine atom at the 3-position of the benzene ring adds to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid with a distinctive almond-like odor, characteristic of benzaldehyde derivatives. It is soluble in organic solvents and exhibits moderate volatility. The presence of multiple methyl groups contributes to its hydrophobic nature and can influence its boiling point and melting point. Additionally, the fluorine substitution can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical applications, including synthesis and as a potential intermediate in organic reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H13FO
InChI:InChI=1S/C11H13FO/c1-6-7(2)10(5-13)9(4)11(12)8(6)3/h5H,1-4H3
InChI key:InChIKey=NLIHXYBNRJXIIV-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C)C(C)=C(C)C(F)=C1C
Synonyms:- 3-Fluoro-2,4,5,6-tetramethylbenzaldehyde
- Benzaldehyde, 3-fluoro-2,4,5,6-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
