CAS 88174-62-3

2-Cyclohexen-1-one, 5-(2,6-dibromo-4-methylphenyl)-3-hydroxy-

Description:

2-Cyclohexen-1-one, 5-(2,6-dibromo-4-methylphenyl)-3-hydroxy- is an organic compound characterized by its unique structure, which includes a cyclohexene ring and various functional groups. The presence of a ketone group (cyclohexenone) indicates that it is a conjugated system, which can exhibit interesting reactivity and stability. The compound also features a hydroxyl group, contributing to its potential as a phenolic compound, which may enhance its solubility in polar solvents and influence its reactivity in chemical reactions. The dibromo and methyl substituents on the phenyl ring suggest that the compound may have significant steric and electronic effects, potentially impacting its biological activity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its structural characteristics and potential applications. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₃H₁₂Br₂O₂

InChI: InChI=1S/C13H12Br2O2/c1-7-2-11(14)13(12(15)3-7)8-4-9(16)6-10(17)5-8/h2-3,6,8,16H,4-5H2,1H3

InChI key: MLUNUCOPYRTPRJ-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C(=C1)Br)C2CC(=CC(=O)C2)O)Br