CAS 88174-63-4

2-Cyclohexen-1-one, 5-(4-bromo-2,6-dimethylphenyl)-3-hydroxy-

Description:

2-Cyclohexen-1-one, 5-(4-bromo-2,6-dimethylphenyl)-3-hydroxy- is an organic compound characterized by its unique bicyclic structure, which includes a cyclohexene ring and a phenolic moiety. The presence of the bromo substituent on the phenyl ring enhances its reactivity and may influence its biological activity. The hydroxyl group contributes to its potential as a hydrogen bond donor, which can affect solubility and interaction with other molecules. This compound may exhibit interesting properties such as potential antioxidant activity or serve as a precursor in synthetic organic chemistry. Its molecular structure suggests it could participate in various chemical reactions, including electrophilic aromatic substitution or nucleophilic addition, due to the presence of both electron-withdrawing and electron-donating groups. Additionally, the compound's specific stereochemistry and functional groups may impart unique physical properties, such as melting point, boiling point, and solubility in different solvents. Overall, 2-Cyclohexen-1-one, 5-(4-bromo-2,6-dimethylphenyl)-3-hydroxy- is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₅BrO₂

InChI: InChI=1S/C14H15BrO2/c1-8-3-11(15)4-9(2)14(8)10-5-12(16)7-13(17)6-10/h3-4,7,10,16H,5-6H2,1-2H3

InChI key: BSRIPLZMGZFCRC-UHFFFAOYSA-N

SMILES: CC1=CC(=CC(=C1C2CC(=CC(=O)C2)O)C)Br