CAS 88174-66-7

2-Cyclohexen-1-one, 5-(3-chloro-2,4,6-trimethylphenyl)-3-hydroxy-

Description:

2-Cyclohexen-1-one, 5-(3-chloro-2,4,6-trimethylphenyl)-3-hydroxy- is an organic compound characterized by its unique bicyclic structure, which includes a cyclohexene ring and a ketone functional group. The presence of a hydroxyl group (-OH) and a chloro-substituted aromatic ring contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of both ketones and phenolic compounds, such as being a potential electrophile due to the carbonyl group and possessing hydrogen-bonding capabilities due to the hydroxyl group. Its chlorinated aromatic moiety may enhance its biological activity or influence its solubility in various solvents. The compound's molecular structure suggests it could be of interest in fields such as medicinal chemistry or materials science, where derivatives may be explored for their pharmacological properties or as intermediates in synthetic pathways. As with many organic compounds, safety and handling precautions should be observed, given the presence of chlorine and the potential for reactivity.

Formula: C₁₅H₁₇ClO₂

InChI: InChI=1S/C15H17ClO2/c1-8-4-9(2)15(16)10(3)14(8)11-5-12(17)7-13(18)6-11/h4,7,11,17H,5-6H2,1-3H3

InChI key: GGINUKZVVPTTFI-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C(=C1C2CC(=CC(=O)C2)O)C)Cl)C