
CAS 881743-75-5
:2′-Fluoro-5′-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1′-biphenyl]-2-carbonitrile
Description:
2′-Fluoro-5′-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1′-biphenyl]-2-carbonitrile is a chemical compound characterized by its complex structure, which includes a biphenyl moiety, a fluorine atom, and a carbonitrile functional group. The presence of the dioxaborolane group indicates that it may have applications in organoboron chemistry, particularly in cross-coupling reactions, which are valuable in synthetic organic chemistry. The fluorine substituent can enhance the compound's electronic properties, potentially influencing its reactivity and solubility. Additionally, the tetramethyl groups contribute to steric hindrance, which may affect the compound's interactions with other molecules. This compound is likely to be of interest in the development of pharmaceuticals or advanced materials due to its unique structural features. As with many organoboron compounds, it may exhibit specific reactivity patterns, making it useful in various chemical transformations. Safety and handling precautions should be observed, as with all chemical substances, particularly those involving boron and fluorine.
Formula:C19H19BFNO2
InChI:InChI=1S/C19H19BFNO2/c1-18(2)19(3,4)24-20(23-18)14-9-10-17(21)16(11-14)15-8-6-5-7-13(15)12-22/h5-11H,1-4H3
InChI key:InChIKey=PELFSPIQQQEARZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(C2=CC(=C(F)C=C2)C3=C(C#N)C=CC=C3)OC1(C)C
Synonyms:- 2′-Fluoro-5′-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1′-biphenyl]-2-carbonitrile
- [1,1′-Biphenyl]-2-carbonitrile, 2′-fluoro-5′-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2′-Fluoro-5′-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)biphenyl-2-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

