CAS 88175-91-1

1,3-Cyclohexanedione, 5-(3-fluoro-2,4,6-trimethylphenyl)-2-(1-oxobutyl)-

Description:

1,3-Cyclohexanedione, 5-(3-fluoro-2,4,6-trimethylphenyl)-2-(1-oxobutyl)-, identified by CAS number 88175-91-1, is a synthetic organic compound characterized by its bicyclic structure featuring two ketone functional groups. This compound exhibits a complex molecular architecture, incorporating a cyclohexanedione core and a substituted aromatic ring, which contributes to its unique chemical properties. The presence of the fluoro substituent enhances its reactivity and may influence its electronic properties, while the bulky trimethyl groups can affect steric hindrance and solubility. The ketone functionalities suggest potential for reactivity in condensation reactions or as a precursor in various synthetic pathways. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.

Formula: C₁₉H₂₃FO₃

InChI: InChI=1S/C19H23FO3/c1-5-6-14(21)18-15(22)8-13(9-16(18)23)17-10(2)7-11(3)19(20)12(17)4/h7,13,18H,5-6,8-9H2,1-4H3

InChI key: QUJBJBMXNFSUHU-UHFFFAOYSA-N

SMILES: CCCC(=O)C1C(=O)CC(CC1=O)C2=C(C(=C(C=C2C)C)F)C