CAS 88176-45-8

1,3-Cyclohexanedione, 5-(2-chloro-3,4,5,6-tetramethylphenyl)-

Description:

1,3-Cyclohexanedione, 5-(2-chloro-3,4,5,6-tetramethylphenyl)-, with CAS number 88176-45-8, is an organic compound characterized by its bicyclic structure featuring a cyclohexanedione moiety and a substituted aromatic ring. The presence of the 2-chloro-3,4,5,6-tetramethylphenyl group indicates that the compound has significant steric hindrance and potential for unique reactivity due to the electron-donating and electron-withdrawing effects of the substituents. This compound is likely to exhibit properties typical of diketones, such as the ability to participate in various chemical reactions, including condensation and nucleophilic addition. Its chlorinated aromatic component may also impart specific characteristics, such as increased lipophilicity and potential biological activity. The compound's solubility, stability, and reactivity can vary based on the solvent and conditions used. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₆H₁₉ClO₂

InChI: InChI=1S/C16H19ClO2/c1-8-9(2)11(4)16(17)15(10(8)3)12-5-13(18)7-14(19)6-12/h12H,5-7H2,1-4H3

InChI key: WGSBOXFCFCCJHW-UHFFFAOYSA-N

SMILES: CC1=C(C(=C(C(=C1C)C2CC(=O)CC(=O)C2)Cl)C)C