CAS 88176-47-0

1,3-Cyclohexanedione, 5-(4-methoxy-2,3,5,6-tetramethylphenyl)-

Description:

1,3-Cyclohexanedione, 5-(4-methoxy-2,3,5,6-tetramethylphenyl)-, identified by its CAS number 88176-47-0, is an organic compound characterized by its bicyclic structure featuring a cyclohexanedione moiety. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, which is common for many substituted cyclohexanediones. The presence of the methoxy and tetramethylphenyl groups contributes to its unique chemical properties, including potential reactivity and stability under various conditions. It may participate in various chemical reactions, such as condensation and substitution, due to the presence of reactive functional groups. Additionally, this compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its specific applications and behavior in reactions would depend on the context of use, including potential roles in synthesis or as a precursor in the development of more complex molecules. As with all chemical substances, proper handling and safety measures should be observed due to potential hazards associated with its use.

Formula: C₁₇H₂₂O₃

InChI: InChI=1S/C17H22O3/c1-9-11(3)17(20-5)12(4)10(2)16(9)13-6-14(18)8-15(19)7-13/h13H,6-8H2,1-5H3

InChI key: YUXHWXNAXCXVKK-UHFFFAOYSA-N

SMILES: CC1=C(C(=C(C(=C1C2CC(=O)CC(=O)C2)C)C)OC)C