CAS 88176-53-8

1,3-Cyclohexanedione, 5-(6-chloro-2,3,4-trimethylphenyl)-

Description:

1,3-Cyclohexanedione, 5-(6-chloro-2,3,4-trimethylphenyl)-, identified by CAS number 88176-53-8, is an organic compound characterized by its bicyclic structure featuring a cyclohexanedione core. This compound contains a chloro-substituted aromatic ring, which contributes to its unique chemical properties. The presence of multiple methyl groups on the aromatic ring enhances its hydrophobic character and may influence its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit potential applications in organic synthesis, pharmaceuticals, and as intermediates in the production of more complex molecules. The chloro substituent can also impart specific electronic effects, potentially affecting the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the compound's structural features may allow for various interactions, including hydrogen bonding and π-π stacking, which could be relevant in biological systems or material science applications. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or environmental impact.

Formula: C₁₅H₁₇ClO₂

InChI: InChI=1S/C15H17ClO2/c1-8-4-14(16)15(10(3)9(8)2)11-5-12(17)7-13(18)6-11/h4,11H,5-7H2,1-3H3

InChI key: HFEGKKVAULESKD-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C(=C1C)C)C2CC(=O)CC(=O)C2)Cl