CAS 88176-54-9

1,3-Cyclohexanedione, 5-(6-bromo-2,3,4-trimethylphenyl)-

Description:

1,3-Cyclohexanedione, 5-(6-bromo-2,3,4-trimethylphenyl)-, identified by CAS number 88176-54-9, is an organic compound characterized by its bicyclic structure featuring a cyclohexanedione core. This compound contains a bromo-substituted aromatic ring, which contributes to its unique chemical properties and reactivity. The presence of the bromine atom enhances its electrophilic character, making it potentially useful in various chemical reactions, including substitution and coupling reactions. The trimethyl groups on the aromatic ring can influence the compound's steric and electronic properties, affecting its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and material science. Additionally, the presence of multiple functional groups suggests that it could participate in diverse chemical transformations, which may be exploited in synthetic applications. Overall, this compound represents a complex structure with potential utility in various fields of chemistry, including organic synthesis and pharmaceuticals.

Formula: C₁₅H₁₇BrO₂

InChI: InChI=1S/C15H17BrO2/c1-8-4-14(16)15(10(3)9(8)2)11-5-12(17)7-13(18)6-11/h4,11H,5-7H2,1-3H3

InChI key: OQSHLTZKWBJXCH-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C(=C1C)C)C2CC(=O)CC(=O)C2)Br