CymitQuimica logo

CAS 88179-66-2

:

5-[(3,4,5-Trimethoxyphenyl)methyl]-2,4-pyridinediamine

Description:
5-[(3,4,5-Trimethoxyphenyl)methyl]-2,4-pyridinediamine, with the CAS number 88179-66-2, is an organic compound characterized by its complex structure, which includes a pyridine ring and a substituted phenyl group. This compound features two amino groups (diamines) attached to the pyridine, enhancing its potential for various chemical interactions. The presence of three methoxy groups on the phenyl ring contributes to its hydrophobic character and may influence its solubility and reactivity. The trimethoxy substitution can also affect the compound's electronic properties, potentially enhancing its biological activity. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, this compound exemplifies the intricate relationship between molecular structure and potential biological function.
Formula:C15H19N3O3
InChI:InChI=1S/C15H19N3O3/c1-19-12-5-9(6-13(20-2)15(12)21-3)4-10-8-18-14(17)7-11(10)16/h5-8H,4H2,1-3H3,(H4,16,17,18)
InChI key:InChIKey=XKLSOFDVKIHSKK-UHFFFAOYSA-N
SMILES:C(C1=CC(OC)=C(OC)C(OC)=C1)C=2C(N)=CC(N)=NC2
Synonyms:
  • 5-[(3,4,5-Trimethoxyphenyl)methyl]-2,4-pyridinediamine
  • 2,4-Pyridinediamine, 5-[(3,4,5-trimethoxyphenyl)methyl]-
  • 3-Deazatrimethoprim
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.