CAS 88179-68-4

4,7-Epoxy-1H-isoindole-1,3(2H)-dione, hexahydro-2-hydroxy-

Description:

4,7-Epoxy-1H-isoindole-1,3(2H)-dione, hexahydro-2-hydroxy- is a chemical compound characterized by its unique bicyclic structure, which includes an isoindole core with an epoxy group and a hydroxyl group. This compound typically exhibits properties associated with both its aromatic and aliphatic components, contributing to its potential reactivity and stability. The presence of the epoxy group suggests that it may participate in various chemical reactions, such as ring-opening or nucleophilic attacks, making it a versatile intermediate in organic synthesis. Additionally, the hydroxyl group can enhance solubility in polar solvents and may influence the compound's biological activity. The compound's molecular structure indicates potential applications in pharmaceuticals, agrochemicals, or as a building block in material science. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values. Overall, this compound's unique features make it an interesting subject for further research and application in various chemical fields.

Formula: C₈H₉NO₄

InChI: InChI=1S/C8H9NO4/c10-7-5-3-1-2-4(13-3)6(5)8(11)9(7)12/h3-6,12H,1-2H2

InChI key: SHKHCVKMZYADDO-UHFFFAOYSA-N

SMILES: C1CC2C3C(C1O2)C(=O)N(C3=O)O