CAS 88180-95-4

Cyclopropene, 1-bromo-2-chloro-

Description:

Cyclopropene, 1-bromo-2-chloro- is a halogenated cyclopropene compound characterized by its three-membered carbon ring structure, which is known for its inherent strain and reactivity. The presence of both bromine and chlorine substituents on the cyclopropene ring significantly influences its chemical behavior, making it a valuable intermediate in organic synthesis. This compound typically exhibits a colorless to pale yellow appearance and has a distinctive odor. Its reactivity is attributed to the strained cyclopropene framework, which can undergo various reactions such as electrophilic addition and substitution. The presence of halogens enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, cyclopropene derivatives are of interest in materials science and medicinal chemistry due to their unique structural properties. Safety considerations are important when handling this compound, as it may pose hazards typical of halogenated organic compounds, including potential toxicity and environmental concerns. Overall, cyclopropene, 1-bromo-2-chloro- serves as an intriguing subject for further research in synthetic organic chemistry.

Formula: C₃H₂BrCl

InChI: InChI=1S/C3H2BrCl/c4-2-1-3(2)5/h1H2

InChI key: VSUHHLWWOPEBAV-UHFFFAOYSA-N

SMILES: C1C(=C1Br)Cl