CAS 88181-75-3
:2-methyl-1-(nitroperoxy)prop-2-en-1-one
Description:
2-Methyl-1-(nitroperoxy)prop-2-en-1-one, with the CAS number 88181-75-3, is an organic compound characterized by its unique structure that includes both a nitroperoxy group and an enone functional group. This compound typically exhibits properties associated with both peroxides and unsaturated carbonyl compounds, making it reactive and potentially explosive under certain conditions. The presence of the nitroperoxy group suggests that it may have oxidizing properties, which can lead to vigorous reactions, especially in the presence of heat or shock. Additionally, the enone structure contributes to its reactivity, allowing for potential participation in various organic reactions, such as Michael additions or Diels-Alder reactions. Due to its chemical characteristics, handling and storage of this compound require caution, as it may pose risks related to stability and reactivity. Overall, 2-methyl-1-(nitroperoxy)prop-2-en-1-one is a specialized compound with applications in organic synthesis, but its safety profile must be carefully considered.
Formula:C4H5NO5
InChI:InChI=1/C4H5NO5/c1-3(2)4(6)9-10-5(7)8/h1H2,2H3
Synonyms:- Peroxide, 2-methyl-1-oxo-2-propenyl nitro
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
