CAS 88182-32-5

Glycinamide, 3,5-dibromo-L-tyrosyl-D-alanyl-N-(1,3-dimethylbutyl)-

Description:

Glycinamide, 3,5-dibromo-L-tyrosyl-D-alanyl-N-(1,3-dimethylbutyl)- is a synthetic compound characterized by its complex structure, which includes amino acid derivatives and halogen substituents. The presence of the dibromo groups indicates that it has two bromine atoms attached to the aromatic ring of the tyrosine moiety, which can influence its reactivity and biological activity. The compound features a glycinamide backbone, suggesting potential interactions in biological systems, particularly in peptide synthesis or as a pharmaceutical intermediate. The N-(1,3-dimethylbutyl) substituent may enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological membranes. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological activity, toxicity, and potential applications.

Formula: C₂₀H₃₀Br₂N₄O₄

InChI: InChI=1S/C20H30Br2N4O4/c1-10(2)5-11(3)25-17(27)9-24-19(29)12(4)26-20(30)16(23)8-13-6-14(21)18(28)15(22)7-13/h6-7,10-12,16,28H,5,8-9,23H2,1-4H3,(H,24,29)(H,25,27)(H,26,30)/t11?,12-,16+/m1/s1

InChI key: QDOLXRHLTIUEJZ-KMQIDDJNSA-N

SMILES: C[C@H](C(=O)NCC(=O)NC(C)CC(C)C)NC(=O)[C@H](CC1=CC(=C(C(=C1)Br)O)Br)N