CAS 88182-33-6
:Levistolide A
Description:
Levistolide A, with the CAS number 88182-33-6, is a natural compound classified as a sesquiterpene. It is primarily derived from the essential oil of certain plants, particularly those in the Asteraceae family. This compound is known for its distinctive aromatic properties, contributing to its use in perfumery and flavoring applications. Chemically, Levistolide A features a complex structure characterized by multiple rings and functional groups, which contribute to its unique scent profile. It exhibits potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in both pharmaceutical and cosmetic formulations. Additionally, Levistolide A is recognized for its stability under various conditions, which enhances its utility in various applications. Its natural origin and appealing fragrance profile also make it a subject of research in the field of green chemistry, where there is a growing emphasis on sustainable and eco-friendly sourcing of chemical compounds. Overall, Levistolide A represents a fascinating intersection of chemistry, biology, and industry.
Formula:C24H28O4
InChI:InChI=1S/C24H28O4/c1-3-5-7-18-16-10-9-15-14-11-12-24(21(15)20(16)23(26)27-18)17(13-14)22(25)28-19(24)8-6-4-2/h7-8,13-15,21H,3-6,9-12H2,1-2H3/b18-7-,19-8-/t14-,15+,21-,24+/m1/s1
InChI key:InChIKey=UBBRXVRQZJSDAK-ZJHGLIIDSA-N
SMILES:C(\CCC)=C\1/[C@@]23[C@]4(C5=C(\C(=C\CCC)\OC5=O)CC[C@]4([C@@](C=C2C(=O)O1)(CC3)[H])[H])[H]
Synonyms:- (1Z,5S,5aS,8Z,10bS,10cS)-1,8-Dibutylidene-5,5a,6,7,8,10b-hexahydro-1H-5,10c-ethanonaphtho[1,2-c:7,8-c′]difuran-3,10-dione
- (Z,Z)-Diligustilide
- 1H-5,10c-Ethanonaphtho[1,2-c:7,8-c′]difuran-3,10-dione, 1,8-dibutylidene-5,5a,6,7,8,10b-hexahydro-, (1Z,5S,5aS,8Z,10bS,10cS)-
- 1H-5,10c-Ethanonaphtho[1,2-c:7,8-c′]difuran-3,10-dione, 1,8-dibutylidene-5,5a,6,7,8,10b-hexahydro-, [5S-(1Z,5α,5aα,8Z,10bα,10cα)]-
- Diligustilide
- Levistilide A
- Levistolid A
- Levistolide A
- Z,Z′-6,6′,7,3′a-Diligustilide
- Levistilide A/Levistolid A
- Levistilide A, 98%, from Angelica sinensis (Oliv.) Diels
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Levistolide A
CAS:1. Levistolide A (Diligustilide) inhibits liver fibrosis and angiogenesis.Formula:C24H28O4Purity:98.93% - 99.22%Color and Shape:SolidMolecular weight:380.48Ref: TM-T6S1292
1mg34.00€5mg65.00€10mg94.00€25mg137.00€50mg193.00€100mg286.00€200mg423.00€1mL*10mM (DMSO)73.00€Levistilide A
CAS:Levistilide A is a bioactive compound, which is a phthalide lactone, derived from the roots of certain plants such as Ligusticum chuanxiong and Angelica sinensis. These plants are commonly found in herbal medicine and have been used traditionally for various therapeutic purposes. Levistilide A has garnered scientific interest due to its notable pharmacological activities.Formula:C24H28O4Purity:Min. 95%Color and Shape:PowderMolecular weight:380.48 g/mol





