CAS 88183-49-7
:2-ethoxypropan-1-amine
Description:
2-Ethoxypropan-1-amine, with the CAS number 88183-49-7, is an organic compound characterized by its amine functional group and an ethoxy substituent. It typically appears as a colorless to pale yellow liquid with a moderate boiling point and a relatively low vapor pressure, indicating it is not highly volatile. The presence of the ethoxy group contributes to its solubility in organic solvents, while the amine group can engage in hydrogen bonding, enhancing its solubility in water to some extent. This compound is likely to exhibit basic properties due to the amine functionality, allowing it to act as a nucleophile in various chemical reactions. Additionally, it may have applications in the synthesis of pharmaceuticals or as an intermediate in organic synthesis. Safety data should be consulted for handling, as amines can be irritants and may pose health risks if inhaled or ingested. Overall, 2-ethoxypropan-1-amine is a versatile compound with potential utility in chemical research and industry.
Formula:C5H13NO
InChI:InChI=1/C5H13NO/c1-3-7-5(2)4-6/h5H,3-4,6H2,1-2H3
SMILES:CCOC(C)CN
Synonyms:- 1-Propanamine, 2-Ethoxy-
- 2-Ethoxypropan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
