
CAS 881833-31-4
:Poly[oxy(1-methyl-2-oxo-1,2-ethanediyl)], α-(1-oxo-2-propen-1-yl)-ω-(2-hydroxyethoxy)-, ether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) (2:1), triblock
Description:
The chemical substance known as Poly[oxy(1-methyl-2-oxo-1,2-ethanediyl)], α-(1-oxo-2-propen-1-yl)-ω-(2-hydroxyethoxy)-, ether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) (2:1), triblock, identified by CAS number 881833-31-4, is a complex triblock copolymer. This polymer typically exhibits amphiphilic properties, meaning it has both hydrophilic (water-attracting) and hydrophobic (water-repelling) segments, which can facilitate its use in various applications such as drug delivery systems, emulsifiers, and surfactants. The structure includes poly(ethylene glycol) (PEG) segments, which enhance solubility and biocompatibility, making it suitable for biomedical applications. Additionally, the presence of functional groups allows for further chemical modifications, enabling the tailoring of its properties for specific uses. The molecular weight and specific physical properties can vary based on the synthesis conditions and the ratio of the components in the triblock structure. Overall, this polymer is characterized by its versatility and potential for use in advanced materials and pharmaceutical formulations.
Formula:(C3H4O2)n(C3H4O2)n(C2H4O)nC10H14O5
Synonyms:- Poly[oxy(1-methyl-2-oxo-1,2-ethanediyl)], α-(1-oxo-2-propen-1-yl)-ω-(2-hydroxyethoxy)-, ether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) (2:1), triblock
- Poly[oxy(1-methyl-2-oxo-1,2-ethanediyl)], α-(1-oxo-2-propenyl)-ω-(2-hydroxyethoxy)-, ether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) (2:1), triblock
- AI 102
- PEG-bis-(PLA-acrylate)
- DL-Lactide-ethylene oxide triblock copolymer diacrylate, sru
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Poly[oxy(1-methyl-2-oxo-1,2-ethanediyl)], α-(1-oxo-2-propen-1-yl)-ω-(2-hydroxyethoxy)-, ether with α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) (2:1), triblock
CAS:Formula:C18H26O10Molecular weight:402.3930
