CAS 88184-17-2
:5-methyl-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol
Description:
5-Methyl-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol, with the CAS number 88184-17-2, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple fused aromatic rings and hydroxyl groups. This compound is a derivative of chrysene, featuring a methyl group and four hydroxyl groups that contribute to its chemical properties. The presence of these hydroxyl groups enhances its solubility in polar solvents and may influence its reactivity and biological activity. As a polycyclic aromatic compound, it may exhibit interesting electronic properties and potential applications in organic electronics or as a precursor in organic synthesis. Additionally, compounds of this nature can be of interest in environmental chemistry due to their potential formation in combustion processes and their implications for human health and the environment. However, specific studies on the toxicity, stability, and reactivity of 5-methyl-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol may be limited, necessitating further research to fully understand its characteristics and applications.
Formula:C19H18O4
InChI:InChI=1/C19H18O4/c1-9-8-10-4-2-3-5-11(10)12-6-7-13-15(14(9)12)17(21)19(23)18(22)16(13)20/h2-8,16-23H,1H3
Synonyms:- 1,2,3,4-Chrysenetetrol, 1,2,3,4-tetrahydro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
