CAS 881841-28-7

2-Formylimidazo[1,2-a]pyridine-6-carbonitrile

Description:

2-Formylimidazo[1,2-a]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a formyl group (-CHO) and a cyano group (-CN) enhances its reactivity and potential for various chemical transformations. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, making it suitable for various synthetic applications. Its structure allows for potential interactions with biological targets, which may be of interest in medicinal chemistry. The compound's reactivity can be attributed to the electrophilic nature of the formyl group and the nucleophilic character of the cyano group, enabling it to participate in condensation reactions and other organic transformations. Additionally, the presence of nitrogen atoms in the rings can influence its electronic properties, making it a candidate for studies in coordination chemistry and material science. Overall, 2-Formylimidazo[1,2-a]pyridine-6-carbonitrile is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₉H₅N₃O

InChI: InChI=1S/C9H5N3O/c10-3-7-1-2-9-11-8(6-13)5-12(9)4-7/h1-2,4-6H

InChI key: InChIKey=ULGBWXPDFRKJMZ-UHFFFAOYSA-N

SMILES: C(=O)C1=CN2C(=N1)C=CC(C#N)=C2

Synonyms:

• 2-Formylimidazo[1,2-a]pyridine-6-carbonitrile
• Imidazo[1,2-a]pyridine-6-carbonitrile, 2-formyl-

2-Formylimidazo[1,2-a]pyridine-6-carbonitrile

CAS: 881841-28-7

Formula: C₉H₅N₃O

Molecular weight: 171.1555

Ref: IN-DA008BMY