CymitQuimica logo

CAS 881841-38-9

:

5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxaldehyde

Description:
5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxaldehyde is an organic compound characterized by its imidazo[1,2-a]pyridine structure, which features a fused ring system containing nitrogen atoms. This compound is notable for its aldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 5 and 7 positions of the imidazo ring influences its chemical properties, including its solubility and stability. Typically, compounds of this class are of interest in medicinal chemistry and may exhibit biological activity, including potential mutagenic properties, as they are structurally related to known carcinogens. The compound's molecular structure allows for various chemical reactions, such as nucleophilic additions and condensation reactions, making it a valuable intermediate in the synthesis of more complex molecules. Safety data and handling precautions should be observed due to its potential biological effects. Overall, 5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxaldehyde represents a significant compound in the study of heterocyclic chemistry and its applications in pharmaceuticals.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-7-3-8(2)12-5-9(6-13)11-10(12)4-7/h3-6H,1-2H3
InChI key:InChIKey=WRJUWDHGLRLXCO-UHFFFAOYSA-N
SMILES:CC=1N2C(=NC(C=O)=C2)C=C(C)C1
Synonyms:
  • 5,7-Dimethylimidazo[1,2-a]pyridine-2-carboxaldehyde
  • Imidazo[1,2-a]pyridine-2-carboxaldehyde, 5,7-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.