CymitQuimica logo

CAS 881844-11-7

:

4-Chloro-1-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridine

Description:
4-Chloro-1-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridine is a chemical compound characterized by its complex structure, which includes an imidazopyridine core substituted with a chloro group and a methoxyphenylmethyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the chloro substituent can influence its reactivity and solubility, while the methoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. The compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and effects can vary based on the context of its use, including the biological systems it is tested against. As with many heterocycles, it may exhibit a range of activities, including antimicrobial, anti-inflammatory, or anticancer properties, making it a subject of interest in drug discovery and development.
Formula:C14H12ClN3O
InChI:InChI=1S/C14H12ClN3O/c1-19-11-4-2-10(3-5-11)8-18-9-17-13-12(18)6-7-16-14(13)15/h2-7,9H,8H2,1H3
InChI key:InChIKey=PRKHXXIHHSVLFA-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1)=C(Cl)N=CC2)C3=CC=C(OC)C=C3
Synonyms:
  • 1H-Imidazo[4,5-c]pyridine, 4-chloro-1-[(4-methoxyphenyl)methyl]-
  • 4-Chloro-1-[(4-methoxyphenyl)methyl]-1H-imidazo[4,5-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.