CAS 88185-03-9

Benzenamine, 2-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-

Description:

Benzenamine, 2-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]- is an organic compound characterized by its aromatic amine structure, which features a benzene ring attached to an amine group. The compound contains a 1,3,4-oxadiazole moiety, which is a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms, contributing to its unique chemical properties. The presence of a methoxy group (-OCH3) on the phenyl ring enhances its electron-donating characteristics, potentially influencing its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in areas such as medicinal chemistry, where derivatives of aromatic amines and heterocycles are often explored for their therapeutic properties. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings and the oxadiazole, which may affect its interactions in various chemical environments. Overall, this compound represents a class of organic molecules with diverse applications in chemical synthesis and biological research.

Formula: C₁₅H₁₃N₃O₂

InChI: InChI=1S/C15H13N3O2/c1-19-11-8-6-10(7-9-11)14-17-18-15(20-14)12-4-2-3-5-13(12)16/h2-9H,16H2,1H3

InChI key: FZJZNABYDBBGHY-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C2=NN=C(O2)C3=CC=CC=C3N