CymitQuimica logo

CAS 88185-17-5

:

chloro-[(2,5-dimethoxyphenyl)methyl]magnesium

Description:
Chloro-[(2,5-dimethoxyphenyl)methyl]magnesium, with the CAS number 88185-17-5, is an organomagnesium compound that belongs to the class of Grignard reagents. These reagents are characterized by their highly reactive nature, particularly towards electrophiles, due to the presence of a carbon-magnesium bond. This specific compound features a chloro group and a 2,5-dimethoxyphenylmethyl moiety, which contributes to its unique reactivity and potential applications in organic synthesis. The presence of the methoxy groups enhances the electron density on the aromatic ring, making it more nucleophilic. As a Grignard reagent, it is typically used in the formation of carbon-carbon bonds, enabling the synthesis of a variety of organic compounds. However, it is sensitive to moisture and air, requiring an anhydrous environment for storage and handling. Safety precautions are essential when working with this compound due to its reactivity and potential hazards associated with organometallic compounds.
Formula:C9H11ClMgO2
InChI:InChI=1/C9H11O2.ClH.Mg/c1-7-6-8(10-2)4-5-9(7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11ClMgO2/c1-12-8-3-4-9(13-2)7(5-8)6-11-10/h3-5H,6H2,1-2H3
SMILES:C=C1C=C(C=CC1OC)OC.Cl.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.