CAS 88185-31-3

1-[(2E)-3-phenylprop-2-en-1-yl]piperazine dihydrochloride

Description:

1-[(2E)-3-phenylprop-2-en-1-yl]piperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenylpropene side chain, contributing to its unique structural and functional properties. The presence of the dihydrochloride indicates that the compound exists as a salt, enhancing its solubility in water and potentially influencing its pharmacological activity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific stereochemistry of the side chain (2E configuration) suggests that it may interact with biological targets in a particular manner, influencing its efficacy and potency. As with many piperazine derivatives, this compound may be investigated for its potential applications in treating various conditions, including neurological disorders or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₂₀Cl₂N₂

InChI: InChI=1/C13H18N2.2ClH/c1-2-5-13(6-3-1)7-4-10-15-11-8-14-9-12-15;;/h1-7,14H,8-12H2;2*1H/b7-4+;;

Synonyms:

• 1-[(2E)-3-Phenyl-2-propen-1-yl]piperazine dihydrochloride
• 1-[(2E)-3-Phenylprop-2-en-1-yl]piperazindihydrochlorid

1-(3-phenylprop-2-en-1-yl)piperazine dihydrochloride

CAS: 88185-31-3

Formula: C₁₃H₂₀Cl₂N₂

Molecular weight: 275.2173

Ref: IN-DA019V45