CAS 88185-90-4

Butanamide, N-(2,6-dihydroxyphenyl)-4,4,4-trifluoro-3-oxo-

Description:

Butanamide, N-(2,6-dihydroxyphenyl)-4,4,4-trifluoro-3-oxo- is a chemical compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a 2,6-dihydroxyphenyl group indicates that it has two hydroxyl (-OH) groups attached to a phenyl ring, contributing to its potential for hydrogen bonding and increased solubility in polar solvents. The trifluoro group (–CF3) enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The keto group (–C=O) in the structure suggests reactivity typical of carbonyl compounds, which may participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique combination of functional groups may impart specific properties such as increased stability, altered reactivity, and potential applications in pharmaceuticals or agrochemicals. Its CAS number, 88185-90-4, allows for easy identification and reference in chemical databases.

Formula: C₁₀H₈F₃NO₄

InChI: InChI=1S/C10H8F3NO4/c11-10(12,13)7(17)4-8(18)14-9-5(15)2-1-3-6(9)16/h1-3,15-16H,4H2,(H,14,18)

InChI key: AYYBAAHDADSUSR-UHFFFAOYSA-N

SMILES: C1=CC(=C(C(=C1)O)NC(=O)CC(=O)C(F)(F)F)O