CAS 88188-89-0

Tellurophenium, 1-(4-ethoxyphenyl)tetrahydro-, bromide

Description:

Tellurophenium, 1-(4-ethoxyphenyl)tetrahydro-, bromide, identified by the CAS number 88188-89-0, is a chemical compound that belongs to the class of organometallic compounds. It features a tellurium atom bonded to a tetrahydro structure and an ethoxyphenyl group, which contributes to its unique properties. The presence of the bromide ion indicates that it is a salt, which can influence its solubility and reactivity. Organotellurium compounds are known for their diverse applications in organic synthesis and materials science, often exhibiting interesting electronic and photophysical properties. The ethoxyphenyl substituent may enhance its solubility in organic solvents and affect its interaction with biological systems. Additionally, tellurophenium compounds can exhibit interesting redox behavior, making them potential candidates for various applications in catalysis and as intermediates in organic reactions. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise evaluation.

Formula: C₁₂H₁₇OTeBr

InChI: InChI=1S/C12H17OTe.BrH/c1-2-13-11-5-7-12(8-6-11)14-9-3-4-10-14;/h5-8H,2-4,9-10H2,1H3;1H/q+1;/p-1

InChI key: WKXJHEMPZFJOJL-UHFFFAOYSA-M

SMILES: CCOC1=CC=C(C=C1)[Te+]2CCCC2.[Br-]