CAS 881891-83-4

2-chloro-5-fluoro-4-methylpyridine

Description:

2-Chloro-5-fluoro-4-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three substituents: a chlorine atom at the 2-position, a fluorine atom at the 5-position, and a methyl group at the 4-position of the pyridine ring. These substitutions influence its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate polarity due to the presence of electronegative halogens, which can also affect their solubility in various solvents. The presence of the chlorine and fluorine atoms may enhance the compound's stability and reactivity in certain chemical reactions, making it of interest in pharmaceutical and agrochemical applications. Additionally, the methyl group can influence the compound's steric properties and overall molecular interactions. As with many halogenated compounds, care should be taken regarding their environmental impact and toxicity.

Formula: C₆H₅ClFN

InChI: InChI=1/C6H5ClFN/c1-4-2-6(7)9-3-5(4)8/h2-3H,1H3

SMILES: Cc1cc(Cl)ncc1F

Synonyms:

• Pyridine, 2-chloro-5-fluoro-4-methyl-
• 2-Chloro-5-fluoro-4-methyl-pyridine

2-chloro-5-fluoro-4-methylpyridine

CAS: 881891-83-4

Formula: C₆H₅ClFN

Purity: 98%

Color and Shape: Solid

Molecular weight: 145.5620

Ref: IN-DA008BJE

2-Chloro-5-fluoro-4-methylpyridine

CAS: 881891-83-4

2-Chloro-5-fluoro-4-methylpyridine

Purity: 97%

Molecular weight: 145.56g/mol

Ref: 54-PC8383

2-Chloro-5-fluoro-4-methylpyridine

CAS: 881891-83-4

Formula: C₆H₅ClFN

Purity: 97%

Color and Shape: Solid

Molecular weight: 145.56

Ref: 10-F036170