CAS 88191-31-5

L-Threonine, N-[N-[N-(N-L-phenylalanyl-L-seryl)-L-leucyl]-L-seryl]-

Description:

L-Threonine, N-[N-[N-(N-L-phenylalanyl-L-seryl)-L-leucyl]-L-seryl]- is a complex peptide compound characterized by its multi-residue structure, which includes the amino acids threonine, phenylalanine, serine, and leucine. This compound is part of a larger class of peptides known for their biological significance, particularly in protein synthesis and metabolic processes. The presence of multiple amino acid residues contributes to its potential functionality in biological systems, including roles in enzyme activity and cellular signaling. The specific arrangement of these amino acids can influence the compound's solubility, stability, and interaction with other biomolecules. Additionally, the compound may exhibit unique properties such as specific binding affinities or biological activities, making it of interest in pharmaceutical and biochemical research. Its CAS number, 88191-31-5, allows for precise identification and reference in scientific literature and databases. Overall, this compound exemplifies the complexity and diversity of peptide structures in biochemistry.

Formula: C₂₅H₃₉N₅O₉

InChI: InChI=1S/C25H39N5O9/c1-13(2)9-17(22(35)29-19(12-32)24(37)30-20(14(3)33)25(38)39)27-23(36)18(11-31)28-21(34)16(26)10-15-7-5-4-6-8-15/h4-8,13-14,16-20,31-33H,9-12,26H2,1-3H3,(H,27,36)(H,28,34)(H,29,35)(H,30,37)(H,38,39)/t14-,16+,17+,18+,19+,20+/m1/s1

InChI key: WERXXNOZRWZYCJ-CISPMOHPSA-N

SMILES: C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CC1=CC=CC=C1)N)O