CAS 88191-39-3
:[[(3Z)-3-Hexenyloxy]methyl]benzene
Description:
The chemical substance known as [[(3Z)-3-Hexenyloxy]methyl]benzene, with the CAS number 88191-39-3, is an organic compound characterized by its aromatic structure due to the presence of a benzene ring. This compound features a hexenyloxy group, which introduces a long carbon chain that contributes to its reactivity and potential applications in various chemical processes. The presence of the double bond in the hexenyloxy group indicates that it can participate in addition reactions, making it useful in synthetic organic chemistry. Additionally, the compound's structure suggests it may exhibit hydrophobic properties due to the alkyl chain, which can influence its solubility in organic solvents. Its potential applications could range from use as an intermediate in the synthesis of more complex molecules to its role in materials science or as a fragrance component, depending on its specific properties and reactivity. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C13H18O
InChI:InChI=1/C13H18O/c1-2-3-4-8-11-14-12-13-9-6-5-7-10-13/h3-7,9-10H,2,8,11-12H2,1H3/b4-3+
InChI key:InChIKey=PCHRJGRKKJOULQ-ARJAWSKDSA-N
SMILES:C(OCC/C=C\CC)C1=CC=CC=C1
Synonyms:- [[(3Z)-3-Hexenyloxy]methyl]benzene
- cis-3-Hexenyl benzyl ether
- Benzene, [(3-hexenyloxy)methyl]-, (Z)-
- Benzene, [[(3Z)-3-hexenyloxy]methyl]-
- {[(3E)-hex-3-en-1-yloxy]methyl}benzene
- (Z)-(Hex-3-enyloxy)toluene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
