CymitQuimica logo

CAS 88191-49-5

:

(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol tetrahydrate

Description:
The chemical substance known as "(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol tetrahydrate," with the CAS number 88191-49-5, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the chromene core, along with the dihydroxyphenyl substituent, suggests that it may exhibit various biological activities, including anti-inflammatory and neuroprotective effects. The tetrahydrate form indicates that the compound can associate with four water molecules, which may influence its solubility and stability in aqueous environments. Such characteristics make it of interest in pharmacological research, particularly in the context of natural products and their therapeutic applications. Its stereochemistry, denoted by the (2R,3S) configuration, is crucial for its biological activity, as the spatial arrangement of atoms can significantly affect how the molecule interacts with biological targets. Overall, this compound represents a fascinating area of study within the field of medicinal chemistry.
Formula:C15H22O10
InChI:InChI=1/C15H14O6.4H2O/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;;;;/h1-5,13,15-20H,6H2;4*1H2/t13-,15+;;;;/m0..../s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.